C24H41N5 — CID 162483903
(4R,9R,15R,20R)-11-ethyl-3,10,14,21,27-pentazatetracyclo[21.3.1.04,9.015,20]heptacosa-1(26),23(27),24-triene (PubChem CID 162483903) has the molecular formula C24H41N5 and a molecular weight of 399.63 g/mol. Its IUPAC name is (4R,9R,15R,20R)-11-ethyl-3,10,14,21,27-pentazatetracyclo[21.3.1.04,9.015,20]heptacosa-1(26),23(27),24-triene.
| Compound Name | (4R,9R,15R,20R)-11-ethyl-3,10,14,21,27-pentazatetracyclo[21.3.1.04,9.015,20]heptacosa-1(26),23(27),24-triene |
|---|---|
| PubChem CID | 162483903 |
| Molecular Formula | C24H41N5 |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 399.34 |
| IUPAC Name | (4R,9R,15R,20R)-11-ethyl-3,10,14,21,27-pentazatetracyclo[21.3.1.04,9.015,20]heptacosa-1(26),23(27),24-triene |
| SMILES | CCC1CCN[C@@H]2CCCC[C@H]2NCc2cccc(n2)CN[C@@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C24H41N5/c1-2-18-14-15-25-21-10-3-4-11-22(21)26-16-19-8-7-9-20(28-19)17-27-23-12-5-6-13-24(23)29-18/h7-9,18,21-27,29H,2-6,10-17H2,1H3/t18?,21-,22-,23-,24-/m1/s1 |
| InChIKey | IFSHSBLGYQIYSR-JRZAHVDZSA-N |
| XLogP | 3.24 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |