C23H39Cl2MnN5 — CID 59867654
dichloromanganese;(2S,4S,9S,14S,19S,21S)-2,21-dimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene (PubChem CID 59867654) has the molecular formula C23H39Cl2MnN5 and a molecular weight of 511.44 g/mol. Its IUPAC name is dichloromanganese;(2S,4S,9S,14S,19S,21S)-2,21-dimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene.
| Compound Name | dichloromanganese;(2S,4S,9S,14S,19S,21S)-2,21-dimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene |
|---|---|
| PubChem CID | 59867654 |
| Molecular Formula | C23H39Cl2MnN5 |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | dichloromanganese;(2S,4S,9S,14S,19S,21S)-2,21-dimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene |
| SMILES | C[C@@H]1N[C@H]2CCCC[C@@H]2NCCN[C@H]2CCCC[C@@H]2N[C@@H](C)c2cccc1n2.Cl[Mn]Cl |
| InChI | InChI=1S/C23H39N5.2ClH.Mn/c1-16-18-12-7-13-19(28-18)17(2)27-23-11-6-4-9-21(23)25-15-14-24-20-8-3-5-10-22(20)26-16;;;/h7,12-13,16-17,20-27H,3-6,8-11,14-15H2,1-2H3;2*1H;/q;;;+2/p-2/t16-,17-,20-,21-,22-,23-;;;/m0.../s1 |
| InChIKey | SGKGFJLYKFOYDK-KYVZIPGBSA-L |
| XLogP | 4.57 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |