C24H41Cl2MnN5 — CID 164740984
dichloromanganese;(2S,4R,9R,11R,14R,19R,21S)-2,11,21-trimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene (PubChem CID 164740984) has the molecular formula C24H41Cl2MnN5 and a molecular weight of 525.47 g/mol. Its IUPAC name is dichloromanganese;(2S,4R,9R,11R,14R,19R,21S)-2,11,21-trimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene.
| Compound Name | dichloromanganese;(2S,4R,9R,11R,14R,19R,21S)-2,11,21-trimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene |
|---|---|
| PubChem CID | 164740984 |
| Molecular Formula | C24H41Cl2MnN5 |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | dichloromanganese;(2S,4R,9R,11R,14R,19R,21S)-2,11,21-trimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene |
| SMILES | C[C@@H]1CN[C@@H]2CCCC[C@H]2N[C@@H](C)c2cccc(n2)[C@H](C)N[C@@H]2CCCC[C@H]2N1.Cl[Mn]Cl |
| InChI | InChI=1S/C24H41N5.2ClH.Mn/c1-16-15-25-21-9-4-5-10-22(21)27-17(2)19-13-8-14-20(29-19)18(3)28-24-12-7-6-11-23(24)26-16;;;/h8,13-14,16-18,21-28H,4-7,9-12,15H2,1-3H3;2*1H;/q;;;+2/p-2/t16-,17+,18+,21-,22-,23-,24-;;;/m1.../s1 |
| InChIKey | ULOCDWPFMILTHX-GZNGIUDFSA-L |
| XLogP | 4.96 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |