C16H35N5 — CID 59936349
(1R,4S,12S,15R)-4,12-dimethyl-2,5,8,11,14-pentazabicyclo[13.4.0]nonadecane (PubChem CID 59936349) has the molecular formula C16H35N5 and a molecular weight of 297.49 g/mol. Its IUPAC name is (1R,4S,12S,15R)-4,12-dimethyl-2,5,8,11,14-pentazabicyclo[13.4.0]nonadecane.
| Compound Name | (1R,4S,12S,15R)-4,12-dimethyl-2,5,8,11,14-pentazabicyclo[13.4.0]nonadecane |
|---|---|
| PubChem CID | 59936349 |
| Molecular Formula | C16H35N5 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.29 |
| IUPAC Name | (1R,4S,12S,15R)-4,12-dimethyl-2,5,8,11,14-pentazabicyclo[13.4.0]nonadecane |
| SMILES | C[C@H]1CN[C@@H]2CCCC[C@H]2NC[C@H](C)NCCNCCN1 |
| InChI | InChI=1S/C16H35N5/c1-13-11-20-15-5-3-4-6-16(15)21-12-14(2)19-10-8-17-7-9-18-13/h13-21H,3-12H2,1-2H3/t13-,14-,15+,16+/m0/s1 |
| InChIKey | FRCUZVODWDSUEF-CAOSSQGBSA-N |
| XLogP | 0.04 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |