C14H30N4 — CID 15872638
(1S,14S)-2,6,9,13-tetrazabicyclo[12.4.0]octadecane (PubChem CID 15872638) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is (1S,14S)-2,6,9,13-tetrazabicyclo[12.4.0]octadecane.
| Compound Name | (1S,14S)-2,6,9,13-tetrazabicyclo[12.4.0]octadecane |
|---|---|
| PubChem CID | 15872638 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | (1S,14S)-2,6,9,13-tetrazabicyclo[12.4.0]octadecane |
| SMILES | C1CNCCNCCCN[C@H]2CCCC[C@@H]2NC1 |
| InChI | InChI=1S/C14H30N4/c1-2-6-14-13(5-1)17-9-3-7-15-11-12-16-8-4-10-18-14/h13-18H,1-12H2/t13-,14-/m0/s1 |
| InChIKey | MZEILKSHDNHCRC-KBPBESRZSA-N |
| XLogP | 0.45 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |