C18H39N5 — CID 143273586
(1R,4S,7R,12S,15R)-4,7,12-trimethyl-2,5,8,11,14-pentazabicyclo[13.5.0]icosane (PubChem CID 143273586) has the molecular formula C18H39N5 and a molecular weight of 325.55 g/mol. Its IUPAC name is (1R,4S,7R,12S,15R)-4,7,12-trimethyl-2,5,8,11,14-pentazabicyclo[13.5.0]icosane.
| Compound Name | (1R,4S,7R,12S,15R)-4,7,12-trimethyl-2,5,8,11,14-pentazabicyclo[13.5.0]icosane |
|---|---|
| PubChem CID | 143273586 |
| Molecular Formula | C18H39N5 |
| Molecular Weight | 325.55 g/mol |
| Exact Mass | 325.32 |
| IUPAC Name | (1R,4S,7R,12S,15R)-4,7,12-trimethyl-2,5,8,11,14-pentazabicyclo[13.5.0]icosane |
| SMILES | C[C@@H]1CN[C@@H](C)CN[C@@H]2CCCCC[C@H]2NC[C@H](C)NCCN1 |
| InChI | InChI=1S/C18H39N5/c1-14-11-21-16(3)13-23-18-8-6-4-5-7-17(18)22-12-15(2)20-10-9-19-14/h14-23H,4-13H2,1-3H3/t14-,15+,16+,17-,18-/m1/s1 |
| InChIKey | SBWBUKNZKIITQZ-DISONHOPSA-N |
| XLogP | 0.81 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.55 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |