C23H39N5 — CID 59867679
(2S,9R,19R,21R)-2,21-dimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene (PubChem CID 59867679) has the molecular formula C23H39N5 and a molecular weight of 385.60 g/mol. Its IUPAC name is (2S,9R,19R,21R)-2,21-dimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene.
| Compound Name | (2S,9R,19R,21R)-2,21-dimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene |
|---|---|
| PubChem CID | 59867679 |
| Molecular Formula | C23H39N5 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.32 |
| IUPAC Name | (2S,9R,19R,21R)-2,21-dimethyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene |
| SMILES | C[C@@H]1NC2CCCC[C@H]2NCCNC2CCCC[C@H]2N[C@H](C)c2cccc1n2 |
| InChI | InChI=1S/C23H39N5/c1-16-18-12-7-13-19(28-18)17(2)27-23-11-6-4-9-21(23)25-15-14-24-20-8-3-5-10-22(20)26-16/h7,12-13,16-17,20-27H,3-6,8-11,14-15H2,1-2H3/t16-,17+,20+,21?,22?,23+/m0/s1 |
| InChIKey | KTPFAQJXCSBAHF-MWYLDSGDSA-N |
| XLogP | 3.20 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |