C21H33Cl2MnN5+2 — CID 59891271
dichloromanganese;10,13,26-triaza-3,20-diazoniatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),2,20,22,24-pentaene (PubChem CID 59891271) has the molecular formula C21H33Cl2MnN5+2 and a molecular weight of 481.37 g/mol. Its IUPAC name is dichloromanganese;10,13,26-triaza-3,20-diazoniatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),2,20,22,24-pentaene.
| Compound Name | dichloromanganese;10,13,26-triaza-3,20-diazoniatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),2,20,22,24-pentaene |
|---|---|
| PubChem CID | 59891271 |
| Molecular Formula | C21H33Cl2MnN5+2 |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | dichloromanganese;10,13,26-triaza-3,20-diazoniatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),2,20,22,24-pentaene |
| SMILES | C1=[NH+]/C2CCCCC2NCCNC2CCCCC2/[NH+]=C/c2cccc/1n2.Cl[Mn]Cl |
| InChI | InChI=1S/C21H31N5.2ClH.Mn/c1-3-10-20-18(8-1)22-12-13-23-19-9-2-4-11-21(19)25-15-17-7-5-6-16(26-17)14-24-20;;;/h5-7,14-15,18-23H,1-4,8-13H2;2*1H;/q;;;+2/b24-14+,25-15+;;; |
| InChIKey | KBQSWQNWFJGYLN-YMCUJNOTSA-N |
| XLogP | 0.27 |
| TPSA | 64.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |