C14H19NOS — CID 79367813
3-ethyl-6-methoxy-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine (PubChem CID 79367813) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-ethyl-6-methoxy-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine.
| Compound Name | 3-ethyl-6-methoxy-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine |
|---|---|
| PubChem CID | 79367813 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-ethyl-6-methoxy-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine |
| SMILES | CCC1CSC2Cc3ccc(OC)cc3C2N1 |
| InChI | InChI=1S/C14H19NOS/c1-3-10-8-17-13-6-9-4-5-11(16-2)7-12(9)14(13)15-10/h4-5,7,10,13-15H,3,6,8H2,1-2H3 |
| InChIKey | CCBLNRHVRHDJMC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |