C14H17NO3S — CID 79368579
methyl 6-methoxy-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylate (PubChem CID 79368579) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is methyl 6-methoxy-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylate.
| Compound Name | methyl 6-methoxy-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylate |
|---|---|
| PubChem CID | 79368579 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | methyl 6-methoxy-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylate |
| SMILES | COC(=O)C1CSC2Cc3ccc(OC)cc3C2N1 |
| InChI | InChI=1S/C14H17NO3S/c1-17-9-4-3-8-5-12-13(10(8)6-9)15-11(7-19-12)14(16)18-2/h3-4,6,11-13,15H,5,7H2,1-2H3 |
| InChIKey | INCKJNKRJVTEML-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |