C18H27NO — CID 175082506
(1S,9S,12S)-11-butan-2-yl-4-methoxy-12-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene (PubChem CID 175082506) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (1S,9S,12S)-11-butan-2-yl-4-methoxy-12-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene.
| Compound Name | (1S,9S,12S)-11-butan-2-yl-4-methoxy-12-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 175082506 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (1S,9S,12S)-11-butan-2-yl-4-methoxy-12-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
| SMILES | CCC(C)C1N[C@@H]2Cc3ccc(OC)cc3[C@@H](C2)[C@@H]1C |
| InChI | InChI=1S/C18H27NO/c1-5-11(2)18-12(3)16-9-14(19-18)8-13-6-7-15(20-4)10-17(13)16/h6-7,10-12,14,16,18-19H,5,8-9H2,1-4H3/t11?,12-,14+,16-,18?/m0/s1 |
| InChIKey | KTSMWCWMRBXZLH-ZECPHISWSA-N |
| XLogP | 3.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |