C17H15NO3S — CID 98546259
(1R,2S,10R,11R,12S)-5-methoxy-19-oxa-10λ4-thia-9-azapentacyclo[10.6.1.02,11.03,8.013,18]nonadeca-3(8),4,6,13,15,17-hexaene 10-oxide (PubChem CID 98546259) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is (1R,2S,10R,11R,12S)-5-methoxy-19-oxa-10λ4-thia-9-azapentacyclo[10.6.1.02,11.03,8.013,18]nonadeca-3(8),4,6,13,15,17-hexaene 10-oxide.
| Compound Name | (1R,2S,10R,11R,12S)-5-methoxy-19-oxa-10λ4-thia-9-azapentacyclo[10.6.1.02,11.03,8.013,18]nonadeca-3(8),4,6,13,15,17-hexaene 10-oxide |
|---|---|
| PubChem CID | 98546259 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (1R,2S,10R,11R,12S)-5-methoxy-19-oxa-10λ4-thia-9-azapentacyclo[10.6.1.02,11.03,8.013,18]nonadeca-3(8),4,6,13,15,17-hexaene 10-oxide |
| SMILES | COc1ccc2c(c1)[C@@H]1[C@H]([C@H]3O[C@H]1c1ccccc13)[S@@](=O)N2 |
| InChI | InChI=1S/C17H15NO3S/c1-20-9-6-7-13-12(8-9)14-15-10-4-2-3-5-11(10)16(21-15)17(14)22(19)18-13/h2-8,14-18H,1H3/t14-,15-,16-,17+,22+/m0/s1 |
| InChIKey | QZUQIGFOFFTNRG-LOKZHVLNSA-N |
| XLogP | 3.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |