C12H12O4 — CID 15467590
(1S,8R,10R)-5,10-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-9-one (PubChem CID 15467590) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is (1S,8R,10R)-5,10-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-9-one.
| Compound Name | (1S,8R,10R)-5,10-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 15467590 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (1S,8R,10R)-5,10-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-9-one |
| SMILES | COc1ccc2c(c1)[C@H]1O[C@@H]2[C@@H](OC)C1=O |
| InChI | InChI=1S/C12H12O4/c1-14-6-3-4-7-8(5-6)10-9(13)12(15-2)11(7)16-10/h3-5,10-12H,1-2H3/t10-,11+,12+/m1/s1 |
| InChIKey | UJFOYHCOHCHEPO-WOPDTQHZSA-N |
| XLogP | 1.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |