C16H16O6 — CID 101360658
(2R,6S,7R,11S)-15-methoxy-4,4-dimethyl-3,5,9-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-8,10-dione (PubChem CID 101360658) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is (2R,6S,7R,11S)-15-methoxy-4,4-dimethyl-3,5,9-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-8,10-dione.
| Compound Name | (2R,6S,7R,11S)-15-methoxy-4,4-dimethyl-3,5,9-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-8,10-dione |
|---|---|
| PubChem CID | 101360658 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (2R,6S,7R,11S)-15-methoxy-4,4-dimethyl-3,5,9-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-8,10-dione |
| SMILES | COc1ccc2c(c1)[C@H]1OC(C)(C)O[C@H]1[C@@H]1C(=O)OC(=O)[C@H]21 |
| InChI | InChI=1S/C16H16O6/c1-16(2)21-12-9-6-7(19-3)4-5-8(9)10-11(13(12)22-16)15(18)20-14(10)17/h4-6,10-13H,1-3H3/t10-,11-,12-,13+/m1/s1 |
| InChIKey | HXSCOOKMJFNPFK-LPWJVIDDSA-N |
| XLogP | 1.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|