C12H12O3 — CID 23587254
2-(6-methoxy-3-oxo-1,2-dihydroinden-1-yl)acetaldehyde (PubChem CID 23587254) has the molecular formula C12H12O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-(6-methoxy-3-oxo-1,2-dihydroinden-1-yl)acetaldehyde.
| Compound Name | 2-(6-methoxy-3-oxo-1,2-dihydroinden-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 23587254 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2-(6-methoxy-3-oxo-1,2-dihydroinden-1-yl)acetaldehyde |
| SMILES | COc1ccc2c(c1)C(CC=O)CC2=O |
| InChI | InChI=1S/C12H12O3/c1-15-9-2-3-10-11(7-9)8(4-5-13)6-12(10)14/h2-3,5,7-8H,4,6H2,1H3 |
| InChIKey | QSJVJTUPYFOGSS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|