C13H15NO4 — CID 86650493
methyl 2-(3-hydroxyimino-6-methoxy-1,2-dihydroinden-1-yl)acetate (PubChem CID 86650493) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl 2-(3-hydroxyimino-6-methoxy-1,2-dihydroinden-1-yl)acetate.
| Compound Name | methyl 2-(3-hydroxyimino-6-methoxy-1,2-dihydroinden-1-yl)acetate |
|---|---|
| PubChem CID | 86650493 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl 2-(3-hydroxyimino-6-methoxy-1,2-dihydroinden-1-yl)acetate |
| SMILES | COC(=O)CC1CC(=NO)c2ccc(OC)cc21 |
| InChI | InChI=1S/C13H15NO4/c1-17-9-3-4-10-11(7-9)8(5-12(10)14-16)6-13(15)18-2/h3-4,7-8,16H,5-6H2,1-2H3 |
| InChIKey | BFPSZKAAMVVPPF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|