C21H29NO3 — CID 173097649
(NE)-N-[(8R,9S,13S,14S,17S)-13-ethyl-2,17-dimethoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]hydroxylamine (PubChem CID 173097649) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (NE)-N-[(8R,9S,13S,14S,17S)-13-ethyl-2,17-dimethoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(8R,9S,13S,14S,17S)-13-ethyl-2,17-dimethoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 173097649 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (NE)-N-[(8R,9S,13S,14S,17S)-13-ethyl-2,17-dimethoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]hydroxylamine |
| SMILES | CC[C@]12CC[C@@H]3c4cc(OC)ccc4/C(=N/O)C[C@H]3[C@@H]1CC[C@@H]2OC |
| InChI | InChI=1S/C21H29NO3/c1-4-21-10-9-14-16-11-13(24-2)5-6-15(16)19(22-23)12-17(14)18(21)7-8-20(21)25-3/h5-6,11,14,17-18,20,23H,4,7-10,12H2,1-3H3/b22-19+/t14-,17-,18+,20+,21+/m1/s1 |
| InChIKey | PCZJUZIUORYJFW-VBDKLCCASA-N |
| XLogP | 4.59 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|