C25H36N2O5 — CID 142203061
(NE)-N-[3-(1-methoxyethoxy)-17-(2-methoxypropan-2-yloxy)-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]nitrous amide (PubChem CID 142203061) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is (NE)-N-[3-(1-methoxyethoxy)-17-(2-methoxypropan-2-yloxy)-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]nitrous amide.
| Compound Name | (NE)-N-[3-(1-methoxyethoxy)-17-(2-methoxypropan-2-yloxy)-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]nitrous amide |
|---|---|
| PubChem CID | 142203061 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | (NE)-N-[3-(1-methoxyethoxy)-17-(2-methoxypropan-2-yloxy)-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-ylidene]nitrous amide |
| SMILES | COC(C)Oc1ccc2c(c1)/C(=N/N=O)CC1C2CCC2(C)C(OC(C)(C)OC)CCC12 |
| InChI | InChI=1S/C25H36N2O5/c1-15(29-5)31-16-7-8-17-18-11-12-25(4)21(9-10-23(25)32-24(2,3)30-6)19(18)14-22(26-27-28)20(17)13-16/h7-8,13,15,18-19,21,23H,9-12,14H2,1-6H3/b26-22+ |
| InChIKey | LXBUWADGWGCQCW-XTCLZLMSSA-N |
| XLogP | 5.61 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|