C26H38O5 — CID 11327890
(8R,9S,13S,14S,17S)-3,17-bis(2-methoxypropan-2-yloxy)-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one (PubChem CID 11327890) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-3,17-bis(2-methoxypropan-2-yloxy)-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (8R,9S,13S,14S,17S)-3,17-bis(2-methoxypropan-2-yloxy)-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 11327890 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (8R,9S,13S,14S,17S)-3,17-bis(2-methoxypropan-2-yloxy)-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
| SMILES | COC(C)(C)Oc1ccc2c(c1)C(=O)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC(C)(C)OC)CC[C@@H]12 |
| InChI | InChI=1S/C26H38O5/c1-24(2,28-6)30-16-8-9-17-18-12-13-26(5)21(19(18)15-22(27)20(17)14-16)10-11-23(26)31-25(3,4)29-7/h8-9,14,18-19,21,23H,10-13,15H2,1-7H3/t18-,19-,21+,23+,26+/m1/s1 |
| InChIKey | NDGRPDPEFXLMPJ-GUWWBVGFSA-N |
| XLogP | 5.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|