C24H32O3 — CID 59403711
(13R,17S)-13,17-dimethyl-3-(oxan-2-yloxy)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one (PubChem CID 59403711) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is (13R,17S)-13,17-dimethyl-3-(oxan-2-yloxy)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (13R,17S)-13,17-dimethyl-3-(oxan-2-yloxy)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 59403711 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (13R,17S)-13,17-dimethyl-3-(oxan-2-yloxy)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
| SMILES | C[C@H]1CCC2C3CC(=O)c4cc(OC5CCCCO5)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C24H32O3/c1-15-6-9-21-19-14-22(25)20-13-16(27-23-5-3-4-12-26-23)7-8-17(20)18(19)10-11-24(15,21)2/h7-8,13,15,18-19,21,23H,3-6,9-12,14H2,1-2H3/t15-,18?,19?,21?,23?,24+/m0/s1 |
| InChIKey | WQGIIQROXIZAOS-ZBFDPRCXSA-N |
| XLogP | 5.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |