C29H40O5 — CID 59725640
(13S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6-carbaldehyde (PubChem CID 59725640) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is (13S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6-carbaldehyde.
| Compound Name | (13S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6-carbaldehyde |
|---|---|
| PubChem CID | 59725640 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | (13S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6-carbaldehyde |
| SMILES | C[C@]12CCC3c4ccc(OC5CCCCO5)cc4C(C=O)CC3C1CC[C@@H]2OC1CCCCO1 |
| InChI | InChI=1S/C29H40O5/c1-29-13-12-22-21-9-8-20(33-27-6-2-4-14-31-27)17-23(21)19(18-30)16-24(22)25(29)10-11-26(29)34-28-7-3-5-15-32-28/h8-9,17-19,22,24-28H,2-7,10-16H2,1H3/t19?,22?,24?,25?,26-,27?,28?,29-/m0/s1 |
| InChIKey | FXYHLWLBGDIBGL-PARDGGEFSA-N |
| XLogP | 6.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|