C41H62F2O5S — CID 71021035
(7S,13S,17S)-7-[9-(4,4-difluorobutylsulfanyl)nonyl]-13-methyl-3,17-bis(oxan-2-yloxy)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one (PubChem CID 71021035) has the molecular formula C41H62F2O5S and a molecular weight of 705.00 g/mol. Its IUPAC name is (7S,13S,17S)-7-[9-(4,4-difluorobutylsulfanyl)nonyl]-13-methyl-3,17-bis(oxan-2-yloxy)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (7S,13S,17S)-7-[9-(4,4-difluorobutylsulfanyl)nonyl]-13-methyl-3,17-bis(oxan-2-yloxy)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 71021035 |
| Molecular Formula | C41H62F2O5S |
| Molecular Weight | 705.00 g/mol |
| Exact Mass | 704.43 |
| IUPAC Name | (7S,13S,17S)-7-[9-(4,4-difluorobutylsulfanyl)nonyl]-13-methyl-3,17-bis(oxan-2-yloxy)-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
| SMILES | C[C@]12CCC3c4ccc(OC5CCCCO5)cc4C(=O)C(CCCCCCCCCSCCCC(F)F)C3C1CC[C@@H]2OC1CCCCO1 |
| InChI | InChI=1S/C41H62F2O5S/c1-41-23-22-31-30-19-18-29(47-37-16-8-10-24-45-37)28-33(30)40(44)32(14-7-5-3-2-4-6-12-26-49-27-13-15-36(42)43)39(31)34(41)20-21-35(41)48-38-17-9-11-25-46-38/h18-19,28,31-32,34-39H,2-17,20-27H2,1H3/t31?,32?,34?,35-,37?,38?,39?,41-/m0/s1 |
| InChIKey | UNHIOHILMCFEIR-SEALEQFKSA-N |
| XLogP | 11.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.00 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|