C31H42O5 — CID 10696544
(7S,8R,9S,13S,14S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-7-prop-2-enyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one (PubChem CID 10696544) has the molecular formula C31H42O5 and a molecular weight of 494.67 g/mol. Its IUPAC name is (7S,8R,9S,13S,14S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-7-prop-2-enyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (7S,8R,9S,13S,14S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-7-prop-2-enyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 10696544 |
| Molecular Formula | C31H42O5 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | (7S,8R,9S,13S,14S,17S)-13-methyl-3,17-bis(oxan-2-yloxy)-7-prop-2-enyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
| SMILES | C=CC[C@@H]1C(=O)c2cc(OC3CCCCO3)ccc2[C@H]2CC[C@]3(C)[C@@H](OC4CCCCO4)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C31H42O5/c1-3-8-23-29-22(15-16-31(2)25(29)13-14-26(31)36-28-10-5-7-18-34-28)21-12-11-20(19-24(21)30(23)32)35-27-9-4-6-17-33-27/h3,11-12,19,22-23,25-29H,1,4-10,13-18H2,2H3/t22-,23+,25+,26+,27?,28?,29+,31+/m1/s1 |
| InChIKey | PULLEMQYJXLLPZ-HTWSRSJESA-N |
| XLogP | 6.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|