C22H24N2O4S — CID 143004555
2-[(3E)-3-[1-[2-formamido-5-(methylaminosulfanyl)phenyl]ethylidene]-6-methoxy-1,2-dihydroinden-1-yl]acetic acid (PubChem CID 143004555) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[(3E)-3-[1-[2-formamido-5-(methylaminosulfanyl)phenyl]ethylidene]-6-methoxy-1,2-dihydroinden-1-yl]acetic acid.
| Compound Name | 2-[(3E)-3-[1-[2-formamido-5-(methylaminosulfanyl)phenyl]ethylidene]-6-methoxy-1,2-dihydroinden-1-yl]acetic acid |
|---|---|
| PubChem CID | 143004555 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[(3E)-3-[1-[2-formamido-5-(methylaminosulfanyl)phenyl]ethylidene]-6-methoxy-1,2-dihydroinden-1-yl]acetic acid |
| SMILES | CNSc1ccc(NC=O)c(/C(C)=C2\CC(CC(=O)O)c3cc(OC)ccc32)c1 |
| InChI | InChI=1S/C22H24N2O4S/c1-13(19-11-16(29-23-2)5-7-21(19)24-12-25)18-8-14(9-22(26)27)20-10-15(28-3)4-6-17(18)20/h4-7,10-12,14,23H,8-9H2,1-3H3,(H,24,25)(H,26,27)/b18-13+ |
| InChIKey | SXNJOBZRCHUZFE-QGOAFFKASA-N |
| XLogP | 4.38 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|