C29H28N2O4 — CID 145233862
N-(4-methoxy-2-phenylphenyl)acetamide;N-(4-methoxy-2-phenylphenyl)formamide (PubChem CID 145233862) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is N-(4-methoxy-2-phenylphenyl)acetamide;N-(4-methoxy-2-phenylphenyl)formamide.
| Compound Name | N-(4-methoxy-2-phenylphenyl)acetamide;N-(4-methoxy-2-phenylphenyl)formamide |
|---|---|
| PubChem CID | 145233862 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-(4-methoxy-2-phenylphenyl)acetamide;N-(4-methoxy-2-phenylphenyl)formamide |
| SMILES | COc1ccc(NC(C)=O)c(-c2ccccc2)c1.COc1ccc(NC=O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C15H15NO2.C14H13NO2/c1-11(17)16-15-9-8-13(18-2)10-14(15)12-6-4-3-5-7-12;1-17-12-7-8-14(15-10-16)13(9-12)11-5-3-2-4-6-11/h3-10H,1-2H3,(H,16,17);2-10H,1H3,(H,15,16) |
| InChIKey | XTLBGUOOUQKSCN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|