About ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine
ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine (PubChem CID 169189354) has the molecular formula C11H21NOS
and a molecular weight of 215.36 g/mol. Its IUPAC name is ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine.
Molecular Properties
| Compound Name | ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine |
| PubChem CID | 169189354 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine |
| SMILES | C.CC.CNSc1ccc(OC)cc1 |
| InChI | InChI=1S/C8H11NOS.C2H6.CH4/c1-9-11-8-5-3-7(10-2)4-6-8;1-2;/h3-6,9H,1-2H3;1-2H3;1H4 |
| InChIKey | HZSUPOSTXMXUOO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine?
The IUPAC name of ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine (CID 169189354) is ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine.
What is the SMILES notation for ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine?
The canonical SMILES for ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine is C.CC.CNSc1ccc(OC)cc1.
What is the InChIKey of ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine?
The InChIKey is HZSUPOSTXMXUOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NOS.C2H6.CH4/c1-9-11-8-5-3-7(10-2)4-6-8;1-2;/h3-6,9H,1-2H3;1-2H3;1H4.
What are the key properties of ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine?
ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine has a molecular weight of 215.36 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;N-(4-methoxyphenyl)sulfanylmethanamine is sourced from PubChem (CID 169189354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).