C10H12O3 — CID 67361681
[(3R)-6-methoxy-2,3-dihydro-1-benzofuran-3-yl]methanol (PubChem CID 67361681) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is [(3R)-6-methoxy-2,3-dihydro-1-benzofuran-3-yl]methanol.
| Compound Name | [(3R)-6-methoxy-2,3-dihydro-1-benzofuran-3-yl]methanol |
|---|---|
| PubChem CID | 67361681 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | [(3R)-6-methoxy-2,3-dihydro-1-benzofuran-3-yl]methanol |
| SMILES | COc1ccc2c(c1)OC[C@H]2CO |
| InChI | InChI=1S/C10H12O3/c1-12-8-2-3-9-7(5-11)6-13-10(9)4-8/h2-4,7,11H,5-6H2,1H3/t7-/m1/s1 |
| InChIKey | JNCZCSYGJCCINS-SSDOTTSWSA-N |
| XLogP | 1.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |