C13H17FO — CID 165409857
4-ethyl-7-fluoro-2,2-dimethyl-3,4-dihydrochromene (PubChem CID 165409857) has the molecular formula C13H17FO and a molecular weight of 208.28 g/mol. Its IUPAC name is 4-ethyl-7-fluoro-2,2-dimethyl-3,4-dihydrochromene.
| Compound Name | 4-ethyl-7-fluoro-2,2-dimethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 165409857 |
| Molecular Formula | C13H17FO |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 4-ethyl-7-fluoro-2,2-dimethyl-3,4-dihydrochromene |
| SMILES | CCC1CC(C)(C)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C13H17FO/c1-4-9-8-13(2,3)15-12-7-10(14)5-6-11(9)12/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | OKYGNLKRCOTDKE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |