C11H14FN — CID 84618460
6-fluoro-3,4-dimethyl-1,2,3,4-tetrahydroquinoline (PubChem CID 84618460) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 6-fluoro-3,4-dimethyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-fluoro-3,4-dimethyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 84618460 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 6-fluoro-3,4-dimethyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CNc2ccc(F)cc2C1C |
| InChI | InChI=1S/C11H14FN/c1-7-6-13-11-4-3-9(12)5-10(11)8(7)2/h3-5,7-8,13H,6H2,1-2H3 |
| InChIKey | HUSLFYFYYVLQMM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |