C9H8ClNO2 — CID 166066797
6-chloro-4-methyl-1,4-dihydro-3,1-benzoxazin-2-one (PubChem CID 166066797) has the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. Its IUPAC name is 6-chloro-4-methyl-1,4-dihydro-3,1-benzoxazin-2-one.
| Compound Name | 6-chloro-4-methyl-1,4-dihydro-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 166066797 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 6-chloro-4-methyl-1,4-dihydro-3,1-benzoxazin-2-one |
| SMILES | CC1OC(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H8ClNO2/c1-5-7-4-6(10)2-3-8(7)11-9(12)13-5/h2-5H,1H3,(H,11,12) |
| InChIKey | QTPCKMGSKIPLHY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |