C12H14ClN — CID 163580754
5-chloro-2-methylidene-3-propan-2-yl-1,3-dihydroindole (PubChem CID 163580754) has the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. Its IUPAC name is 5-chloro-2-methylidene-3-propan-2-yl-1,3-dihydroindole.
| Compound Name | 5-chloro-2-methylidene-3-propan-2-yl-1,3-dihydroindole |
|---|---|
| PubChem CID | 163580754 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 5-chloro-2-methylidene-3-propan-2-yl-1,3-dihydroindole |
| SMILES | C=C1Nc2ccc(Cl)cc2C1C(C)C |
| InChI | InChI=1S/C12H14ClN/c1-7(2)12-8(3)14-11-5-4-9(13)6-10(11)12/h4-7,12,14H,3H2,1-2H3 |
| InChIKey | XUQSMRLVNNDZBR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |