C12H16ClN — CID 105463734
6-chloro-4-propan-2-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 105463734) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is 6-chloro-4-propan-2-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-chloro-4-propan-2-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 105463734 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 6-chloro-4-propan-2-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC(C)C1CCNc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H16ClN/c1-8(2)10-5-6-14-12-4-3-9(13)7-11(10)12/h3-4,7-8,10,14H,5-6H2,1-2H3 |
| InChIKey | WXAROJTYRWBBQI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |