C14H13ClN2OS — CID 43206055
5-chloro-3-(1-thiophen-2-ylethylamino)-1,3-dihydroindol-2-one (PubChem CID 43206055) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is 5-chloro-3-(1-thiophen-2-ylethylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-(1-thiophen-2-ylethylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43206055 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 5-chloro-3-(1-thiophen-2-ylethylamino)-1,3-dihydroindol-2-one |
| SMILES | CC(NC1C(=O)Nc2ccc(Cl)cc21)c1cccs1 |
| InChI | InChI=1S/C14H13ClN2OS/c1-8(12-3-2-6-19-12)16-13-10-7-9(15)4-5-11(10)17-14(13)18/h2-8,13,16H,1H3,(H,17,18) |
| InChIKey | UJAXBHOUTYZULG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |