C38H30Cl2O6 — CID 102018059
(3Z,22Z)-7,19-dichloro-13,33-dimethylidene-11,15,31,35-tetraoxapentacyclo[34.4.0.05,10.016,21.025,30]tetraconta-1(40),3,5(10),6,8,16(21),17,19,22,25,27,29,36,38-tetradecaene-2,24-dione (PubChem CID 102018059) has the molecular formula C38H30Cl2O6 and a molecular weight of 653.56 g/mol. Its IUPAC name is (3Z,22Z)-7,19-dichloro-13,33-dimethylidene-11,15,31,35-tetraoxapentacyclo[34.4.0.05,10.016,21.025,30]tetraconta-1(40),3,5(10),6,8,16(21),17,19,22,25,27,29,36,38-tetradecaene-2,24-dione.
| Compound Name | (3Z,22Z)-7,19-dichloro-13,33-dimethylidene-11,15,31,35-tetraoxapentacyclo[34.4.0.05,10.016,21.025,30]tetraconta-1(40),3,5(10),6,8,16(21),17,19,22,25,27,29,36,38-tetradecaene-2,24-dione |
|---|---|
| PubChem CID | 102018059 |
| Molecular Formula | C38H30Cl2O6 |
| Molecular Weight | 653.56 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | (3Z,22Z)-7,19-dichloro-13,33-dimethylidene-11,15,31,35-tetraoxapentacyclo[34.4.0.05,10.016,21.025,30]tetraconta-1(40),3,5(10),6,8,16(21),17,19,22,25,27,29,36,38-tetradecaene-2,24-dione |
| SMILES | C=C1COc2ccc(Cl)cc2/C=C\C(=O)c2ccccc2OCC(=C)COc2ccccc2C(=O)/C=C\c2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C38H30Cl2O6/c1-25-21-43-35-17-13-29(39)19-27(35)11-15-33(41)31-7-3-5-9-37(31)45-23-26(2)24-46-38-10-6-4-8-32(38)34(42)16-12-28-20-30(40)14-18-36(28)44-22-25/h3-20H,1-2,21-24H2/b15-11-,16-12- |
| InChIKey | VSEYWYBAYAXSHV-NFLUSIDLSA-N |
| XLogP | 9.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.56 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|