C40H36O6 — CID 102018060
(3Z,22Z)-7,19-dimethyl-13,33-dimethylidene-11,15,31,35-tetraoxapentacyclo[34.4.0.05,10.016,21.025,30]tetraconta-1(40),3,5(10),6,8,16(21),17,19,22,25,27,29,36,38-tetradecaene-2,24-dione (PubChem CID 102018060) has the molecular formula C40H36O6 and a molecular weight of 612.72 g/mol. Its IUPAC name is (3Z,22Z)-7,19-dimethyl-13,33-dimethylidene-11,15,31,35-tetraoxapentacyclo[34.4.0.05,10.016,21.025,30]tetraconta-1(40),3,5(10),6,8,16(21),17,19,22,25,27,29,36,38-tetradecaene-2,24-dione.
| Compound Name | (3Z,22Z)-7,19-dimethyl-13,33-dimethylidene-11,15,31,35-tetraoxapentacyclo[34.4.0.05,10.016,21.025,30]tetraconta-1(40),3,5(10),6,8,16(21),17,19,22,25,27,29,36,38-tetradecaene-2,24-dione |
|---|---|
| PubChem CID | 102018060 |
| Molecular Formula | C40H36O6 |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | (3Z,22Z)-7,19-dimethyl-13,33-dimethylidene-11,15,31,35-tetraoxapentacyclo[34.4.0.05,10.016,21.025,30]tetraconta-1(40),3,5(10),6,8,16(21),17,19,22,25,27,29,36,38-tetradecaene-2,24-dione |
| SMILES | C=C1COc2ccc(C)cc2/C=C\C(=O)c2ccccc2OCC(=C)COc2ccccc2C(=O)/C=C\c2cc(C)ccc2OC1 |
| InChI | InChI=1S/C40H36O6/c1-27-13-19-37-31(21-27)15-17-35(41)33-9-5-7-11-39(33)45-25-30(4)26-46-40-12-8-6-10-34(40)36(42)18-16-32-22-28(2)14-20-38(32)44-24-29(3)23-43-37/h5-22H,3-4,23-26H2,1-2H3/b17-15-,18-16- |
| InChIKey | SIHPREIXAPSNKR-IQRFGFHNSA-N |
| XLogP | 8.44 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|