C13H14N6OS — CID 61297339
6-amino-7-(4,6-diaminopyrimidin-2-yl)sulfanyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 61297339) has the molecular formula C13H14N6OS and a molecular weight of 302.36 g/mol. Its IUPAC name is 6-amino-7-(4,6-diaminopyrimidin-2-yl)sulfanyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-7-(4,6-diaminopyrimidin-2-yl)sulfanyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 61297339 |
| Molecular Formula | C13H14N6OS |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 6-amino-7-(4,6-diaminopyrimidin-2-yl)sulfanyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1cc(N)nc(Sc2cc3c(cc2N)CCC(=O)N3)n1 |
| InChI | InChI=1S/C13H14N6OS/c14-7-3-6-1-2-12(20)17-8(6)4-9(7)21-13-18-10(15)5-11(16)19-13/h3-5H,1-2,14H2,(H,17,20)(H4,15,16,18,19) |
| InChIKey | KXZBTCUAKRDDBG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|