C12H18N2O2Si — CID 167723388
6-amino-7-trimethylsilyloxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 167723388) has the molecular formula C12H18N2O2Si and a molecular weight of 250.37 g/mol. Its IUPAC name is 6-amino-7-trimethylsilyloxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-7-trimethylsilyloxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 167723388 |
| Molecular Formula | C12H18N2O2Si |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 6-amino-7-trimethylsilyloxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C[Si](C)(C)Oc1cc2c(cc1N)CCC(=O)N2 |
| InChI | InChI=1S/C12H18N2O2Si/c1-17(2,3)16-11-7-10-8(6-9(11)13)4-5-12(15)14-10/h6-7H,4-5,13H2,1-3H3,(H,14,15) |
| InChIKey | LHBOUULUOIWJKF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|