C12H11NO2 — CID 166929497
6,7,8,9-tetrahydropyrano[2,3-g]quinolin-2-one (PubChem CID 166929497) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 6,7,8,9-tetrahydropyrano[2,3-g]quinolin-2-one.
| Compound Name | 6,7,8,9-tetrahydropyrano[2,3-g]quinolin-2-one |
|---|---|
| PubChem CID | 166929497 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 6,7,8,9-tetrahydropyrano[2,3-g]quinolin-2-one |
| SMILES | O=c1ccc2cc3c(cc2o1)CCCN3 |
| InChI | InChI=1S/C12H11NO2/c14-12-4-3-9-6-10-8(2-1-5-13-10)7-11(9)15-12/h3-4,6-7,13H,1-2,5H2 |
| InChIKey | CXJZUTYKDVGSSQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|