C13H19N3 — CID 71228811
1,2,3,4,6,7,9,10-octahydropyrido[2,3-h][3]benzazepin-8-amine (PubChem CID 71228811) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 1,2,3,4,6,7,9,10-octahydropyrido[2,3-h][3]benzazepin-8-amine.
| Compound Name | 1,2,3,4,6,7,9,10-octahydropyrido[2,3-h][3]benzazepin-8-amine |
|---|---|
| PubChem CID | 71228811 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1,2,3,4,6,7,9,10-octahydropyrido[2,3-h][3]benzazepin-8-amine |
| SMILES | NN1CCc2cc3c(cc2CC1)NCCC3 |
| InChI | InChI=1S/C13H19N3/c14-16-6-3-10-8-12-2-1-5-15-13(12)9-11(10)4-7-16/h8-9,15H,1-7,14H2 |
| InChIKey | DHXGULULHHQCMH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|