C13H14N2O2 — CID 71336504
9-hydroxyimino-1,3,4,6,7,8-hexahydrobenzo[g]quinolin-2-one (PubChem CID 71336504) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 9-hydroxyimino-1,3,4,6,7,8-hexahydrobenzo[g]quinolin-2-one.
| Compound Name | 9-hydroxyimino-1,3,4,6,7,8-hexahydrobenzo[g]quinolin-2-one |
|---|---|
| PubChem CID | 71336504 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 9-hydroxyimino-1,3,4,6,7,8-hexahydrobenzo[g]quinolin-2-one |
| SMILES | O=C1CCc2cc3c(cc2N1)C(=NO)CCC3 |
| InChI | InChI=1S/C13H14N2O2/c16-13-5-4-9-6-8-2-1-3-11(15-17)10(8)7-12(9)14-13/h6-7,17H,1-5H2,(H,14,16) |
| InChIKey | GJTPXNPKFBJIRL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|