C11H11NO3 — CID 10965641
7-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid (PubChem CID 10965641) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 7-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid.
| Compound Name | 7-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 10965641 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 7-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid |
| SMILES | Cc1cc2c(cc1C(=O)O)CCC(=O)N2 |
| InChI | InChI=1S/C11H11NO3/c1-6-4-9-7(2-3-10(13)12-9)5-8(6)11(14)15/h4-5H,2-3H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | JLQOQKWGQIZFLM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |