C17H14FNO2 — CID 63049807
6-(5-fluoro-2-methylbenzoyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 63049807) has the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. Its IUPAC name is 6-(5-fluoro-2-methylbenzoyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(5-fluoro-2-methylbenzoyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 63049807 |
| Molecular Formula | C17H14FNO2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 6-(5-fluoro-2-methylbenzoyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1ccc(F)cc1C(=O)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C17H14FNO2/c1-10-2-5-13(18)9-14(10)17(21)12-3-6-15-11(8-12)4-7-16(20)19-15/h2-3,5-6,8-9H,4,7H2,1H3,(H,19,20) |
| InChIKey | HPXNCQVGFTWLLZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |