C18H21BrN2 — CID 157097766
6-bromo-2,3-dihydro-1H-inden-5-amine;2,3-dihydro-1H-inden-5-amine (PubChem CID 157097766) has the molecular formula C18H21BrN2 and a molecular weight of 345.28 g/mol. Its IUPAC name is 6-bromo-2,3-dihydro-1H-inden-5-amine;2,3-dihydro-1H-inden-5-amine.
| Compound Name | 6-bromo-2,3-dihydro-1H-inden-5-amine;2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 157097766 |
| Molecular Formula | C18H21BrN2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 6-bromo-2,3-dihydro-1H-inden-5-amine;2,3-dihydro-1H-inden-5-amine |
| SMILES | Nc1cc2c(cc1Br)CCC2.Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C9H10BrN.C9H11N/c10-8-4-6-2-1-3-7(6)5-9(8)11;10-9-5-4-7-2-1-3-8(7)6-9/h4-5H,1-3,11H2;4-6H,1-3,10H2 |
| InChIKey | AFKFRJZFZXAHGP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|