C16H16BrNOS — CID 115558623
2-bromo-5-(2,3-dihydro-1H-inden-5-ylsulfinylmethyl)aniline (PubChem CID 115558623) has the molecular formula C16H16BrNOS and a molecular weight of 350.28 g/mol. Its IUPAC name is 2-bromo-5-(2,3-dihydro-1H-inden-5-ylsulfinylmethyl)aniline.
| Compound Name | 2-bromo-5-(2,3-dihydro-1H-inden-5-ylsulfinylmethyl)aniline |
|---|---|
| PubChem CID | 115558623 |
| Molecular Formula | C16H16BrNOS |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-bromo-5-(2,3-dihydro-1H-inden-5-ylsulfinylmethyl)aniline |
| SMILES | Nc1cc(CS(=O)c2ccc3c(c2)CCC3)ccc1Br |
| InChI | InChI=1S/C16H16BrNOS/c17-15-7-4-11(8-16(15)18)10-20(19)14-6-5-12-2-1-3-13(12)9-14/h4-9H,1-3,10,18H2 |
| InChIKey | JVSDNTDPLFRQAK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|