C16H15BrClN — CID 107619769
4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)aniline (PubChem CID 107619769) has the molecular formula C16H15BrClN and a molecular weight of 336.66 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)aniline.
| Compound Name | 4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 107619769 |
| Molecular Formula | C16H15BrClN |
| Molecular Weight | 336.66 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 4-bromo-3-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)aniline |
| SMILES | Clc1cc(NCc2ccc3c(c2)CCC3)ccc1Br |
| InChI | InChI=1S/C16H15BrClN/c17-15-7-6-14(9-16(15)18)19-10-11-4-5-12-2-1-3-13(12)8-11/h4-9,19H,1-3,10H2 |
| InChIKey | AXMJZWWOKBRJAR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |