C17H15ClN2 — CID 63939427
2-chloro-4-(2,3-dihydro-1H-inden-5-ylmethylamino)benzonitrile (PubChem CID 63939427) has the molecular formula C17H15ClN2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 2-chloro-4-(2,3-dihydro-1H-inden-5-ylmethylamino)benzonitrile.
| Compound Name | 2-chloro-4-(2,3-dihydro-1H-inden-5-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 63939427 |
| Molecular Formula | C17H15ClN2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-chloro-4-(2,3-dihydro-1H-inden-5-ylmethylamino)benzonitrile |
| SMILES | N#Cc1ccc(NCc2ccc3c(c2)CCC3)cc1Cl |
| InChI | InChI=1S/C17H15ClN2/c18-17-9-16(7-6-15(17)10-19)20-11-12-4-5-13-2-1-3-14(13)8-12/h4-9,20H,1-3,11H2 |
| InChIKey | SEXYVYWJGQNLTQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |