C14H19BFNO2 — CID 155294315
5-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole (PubChem CID 155294315) has the molecular formula C14H19BFNO2 and a molecular weight of 263.12 g/mol. Its IUPAC name is 5-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole.
| Compound Name | 5-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 155294315 |
| Molecular Formula | C14H19BFNO2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 5-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-indole |
| SMILES | CC1(C)OB(c2cc3c(cc2F)CCN3)OC1(C)C |
| InChI | InChI=1S/C14H19BFNO2/c1-13(2)14(3,4)19-15(18-13)10-8-12-9(5-6-17-12)7-11(10)16/h7-8,17H,5-6H2,1-4H3 |
| InChIKey | ZNNLREAIGGXSFB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|