C15H19BF3NO2 — CID 175163726
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethyl)-2,3-dihydro-1H-indole (PubChem CID 175163726) has the molecular formula C15H19BF3NO2 and a molecular weight of 313.13 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 175163726 |
| Molecular Formula | C15H19BF3NO2 |
| Molecular Weight | 313.13 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethyl)-2,3-dihydro-1H-indole |
| SMILES | CC1(C)OB(c2cc3c(c(C(F)(F)F)c2)NCC3)OC1(C)C |
| InChI | InChI=1S/C15H19BF3NO2/c1-13(2)14(3,4)22-16(21-13)10-7-9-5-6-20-12(9)11(8-10)15(17,18)19/h7-8,20H,5-6H2,1-4H3 |
| InChIKey | QBZZMQDFGFOJJK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.13 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|