C16H19BF4O2 — CID 172644416
2-[4-cyclopropyl-5-fluoro-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 172644416) has the molecular formula C16H19BF4O2 and a molecular weight of 330.13 g/mol. Its IUPAC name is 2-[4-cyclopropyl-5-fluoro-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-cyclopropyl-5-fluoro-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 172644416 |
| Molecular Formula | C16H19BF4O2 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-[4-cyclopropyl-5-fluoro-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(F)c(C3CC3)cc2C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C16H19BF4O2/c1-14(2)15(3,4)23-17(22-14)12-8-13(18)10(9-5-6-9)7-11(12)16(19,20)21/h7-9H,5-6H2,1-4H3 |
| InChIKey | IUPMZARQDRACAO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|