C20H29N5O3 — CID 75366588
tert-butyl 4-[(2Z)-2-hydrazinylidene-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]piperazine-1-carboxylate (PubChem CID 75366588) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl 4-[(2Z)-2-hydrazinylidene-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2Z)-2-hydrazinylidene-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 75366588 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | tert-butyl 4-[(2Z)-2-hydrazinylidene-2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C/C(=N\N)c2ccc3c(c2)CCC(=O)N3)CC1 |
| InChI | InChI=1S/C20H29N5O3/c1-20(2,3)28-19(27)25-10-8-24(9-11-25)13-17(23-21)15-4-6-16-14(12-15)5-7-18(26)22-16/h4,6,12H,5,7-11,13,21H2,1-3H3,(H,22,26)/b23-17+ |
| InChIKey | JKVOGTOHTACBBN-HAVVHWLPSA-N |
| XLogP | 1.79 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|